C24H35N3O3 — CID 92682446
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidine-4-carboxamide (PubChem CID 92682446) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92682446 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)C1CCN(C(=O)N2C[C@@H](C)Oc3ccccc32)CC1 |
| InChI | InChI=1S/C24H35N3O3/c1-16-7-6-8-20(18(16)3)25-23(28)19-11-13-26(14-12-19)24(29)27-15-17(2)30-22-10-5-4-9-21(22)27/h4-5,9-10,16-20H,6-8,11-15H2,1-3H3,(H,25,28)/t16-,17-,18+,20-/m1/s1 |
| InChIKey | JOVXWWRJEMKDFJ-FTEYMNFISA-N |
| XLogP | 4.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |