C20H25ClN2O2 — CID 92682505
(2S)-N-(1-adamantyl)-6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 92682505) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
| Compound Name | (2S)-N-(1-adamantyl)-6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
|---|---|
| PubChem CID | 92682505 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2S)-N-(1-adamantyl)-6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | C[C@H]1CN(C(=O)NC23CC4CC(CC(C4)C2)C3)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-12-11-23(17-7-16(21)2-3-18(17)25-12)19(24)22-20-8-13-4-14(9-20)6-15(5-13)10-20/h2-3,7,12-15H,4-6,8-11H2,1H3,(H,22,24)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | LJLQTYVYECGJNT-PGBBXINNSA-N |
| XLogP | 4.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |