C18H26N2O3 — CID 92682966
1-[(2S)-2-(2,5-dimethylphenoxy)butanoyl]piperidine-4-carboxamide (PubChem CID 92682966) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(2S)-2-(2,5-dimethylphenoxy)butanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-(2,5-dimethylphenoxy)butanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92682966 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[(2S)-2-(2,5-dimethylphenoxy)butanoyl]piperidine-4-carboxamide |
| SMILES | CC[C@H](Oc1cc(C)ccc1C)C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-4-15(23-16-11-12(2)5-6-13(16)3)18(22)20-9-7-14(8-10-20)17(19)21/h5-6,11,14-15H,4,7-10H2,1-3H3,(H2,19,21)/t15-/m0/s1 |
| InChIKey | KJKOIINSEYIXCX-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |