C21H20ClN3O5S2 — CID 92684011
2-chloro-4-(methanesulfonamido)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 92684011) has the molecular formula C21H20ClN3O5S2 and a molecular weight of 493.99 g/mol. Its IUPAC name is 2-chloro-4-(methanesulfonamido)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-4-(methanesulfonamido)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 92684011 |
| Molecular Formula | C21H20ClN3O5S2 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2-chloro-4-(methanesulfonamido)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(NS(C)(=O)=O)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H20ClN3O5S2/c1-14-3-5-16(6-4-14)25-32(29,30)18-10-7-15(8-11-18)23-21(26)19-12-9-17(13-20(19)22)24-31(2,27)28/h3-13,24-25H,1-2H3,(H,23,26) |
| InChIKey | JXGCPWWZYPAVHD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |