C24H25NO2 — CID 92684194
(E)-3-(furan-2-yl)-N-[(1R)-3-methyl-1-phenylbutyl]-2-phenylprop-2-enamide (PubChem CID 92684194) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[(1R)-3-methyl-1-phenylbutyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[(1R)-3-methyl-1-phenylbutyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 92684194 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[(1R)-3-methyl-1-phenylbutyl]-2-phenylprop-2-enamide |
| SMILES | CC(C)C[C@@H](NC(=O)/C(=C/c1ccco1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c1-18(2)16-23(20-12-7-4-8-13-20)25-24(26)22(17-21-14-9-15-27-21)19-10-5-3-6-11-19/h3-15,17-18,23H,16H2,1-2H3,(H,25,26)/b22-17+/t23-/m1/s1 |
| InChIKey | BMEUYFGQUSQEES-YHBLIXGUSA-N |
| XLogP | 5.72 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|