C21H25ClN2O3S — CID 92684263
2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-cyclopentyl-N-methylacetamide (PubChem CID 92684263) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-cyclopentyl-N-methylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-cyclopentyl-N-methylacetamide |
|---|---|
| PubChem CID | 92684263 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-cyclopentyl-N-methylacetamide |
| SMILES | Cc1ccc(N(CC(=O)N(C)C2CCCC2)S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H25ClN2O3S/c1-16-12-13-18(14-20(16)22)24(28(26,27)19-10-4-3-5-11-19)15-21(25)23(2)17-8-6-7-9-17/h3-5,10-14,17H,6-9,15H2,1-2H3 |
| InChIKey | BYBOPLILTQWSCW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |