C19H20Cl2N2O5S — CID 92684423
ethyl 2-chloro-4-[[(2S)-2-(4-chloro-N-methylsulfonylanilino)propanoyl]amino]benzoate (PubChem CID 92684423) has the molecular formula C19H20Cl2N2O5S and a molecular weight of 459.35 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(2S)-2-(4-chloro-N-methylsulfonylanilino)propanoyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[(2S)-2-(4-chloro-N-methylsulfonylanilino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 92684423 |
| Molecular Formula | C19H20Cl2N2O5S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | ethyl 2-chloro-4-[[(2S)-2-(4-chloro-N-methylsulfonylanilino)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](C)N(c2ccc(Cl)cc2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O5S/c1-4-28-19(25)16-10-7-14(11-17(16)21)22-18(24)12(2)23(29(3,26)27)15-8-5-13(20)6-9-15/h5-12H,4H2,1-3H3,(H,22,24)/t12-/m0/s1 |
| InChIKey | RWWMSGYORIZKNT-LBPRGKRZSA-N |
| XLogP | 3.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |