C26H35N3O — CID 92684505
4-(2,3-dihydroindol-1-ylmethyl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]benzamide (PubChem CID 92684505) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylmethyl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylmethyl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 92684505 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylmethyl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]benzamide |
| SMILES | C[C@H]1C[C@H](C)CN(CCCNC(=O)c2ccc(CN3CCc4ccccc43)cc2)C1 |
| InChI | InChI=1S/C26H35N3O/c1-20-16-21(2)18-28(17-20)14-5-13-27-26(30)24-10-8-22(9-11-24)19-29-15-12-23-6-3-4-7-25(23)29/h3-4,6-11,20-21H,5,12-19H2,1-2H3,(H,27,30)/t20-,21-/m0/s1 |
| InChIKey | SUCALXGJYSUDKI-SFTDATJTSA-N |
| XLogP | 4.35 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|