C19H24N2O2 — CID 92685488
1-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-3-phenylurea (PubChem CID 92685488) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-3-phenylurea.
| Compound Name | 1-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-3-phenylurea |
|---|---|
| PubChem CID | 92685488 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-3-phenylurea |
| SMILES | COc1ccc([C@H](CC(C)C)NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-14(2)13-18(15-9-11-17(23-3)12-10-15)21-19(22)20-16-7-5-4-6-8-16/h4-12,14,18H,13H2,1-3H3,(H2,20,21,22)/t18-/m0/s1 |
| InChIKey | HBRDNIIYJZKYBU-SFHVURJKSA-N |
| XLogP | 4.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |