C22H26N4O4 — CID 92687622
2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)-N-[(1S)-1-pyridin-4-ylethyl]acetamide (PubChem CID 92687622) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)-N-[(1S)-1-pyridin-4-ylethyl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)-N-[(1S)-1-pyridin-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 92687622 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)-N-[(1S)-1-pyridin-4-ylethyl]acetamide |
| SMILES | COCCCN(C(=O)Cc1nc(-c2ccc(OC)cc2)no1)[C@@H](C)c1ccncc1 |
| InChI | InChI=1S/C22H26N4O4/c1-16(17-9-11-23-12-10-17)26(13-4-14-28-2)21(27)15-20-24-22(25-30-20)18-5-7-19(29-3)8-6-18/h5-12,16H,4,13-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | XFSBLADKQIUTAP-INIZCTEOSA-N |
| XLogP | 3.31 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|