About 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one
3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 9268780) has the molecular formula C15H14F2N4O4S
and a molecular weight of 384.36 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one |
| PubChem CID | 9268780 |
| Molecular Formula | C15H14F2N4O4S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | O=C(c1ccc(=O)[nH]n1)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H14F2N4O4S/c16-10-1-3-13(11(17)9-10)26(24,25)21-7-5-20(6-8-21)15(23)12-2-4-14(22)19-18-12/h1-4,9H,5-8H2,(H,19,22) |
| InChIKey | YUZZAKYLAVUVDC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one?
The IUPAC name of 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one (CID 9268780) is 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one is O=C(c1ccc(=O)[nH]n1)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1.
What is the InChIKey of 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one?
The InChIKey is YUZZAKYLAVUVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N4O4S/c16-10-1-3-13(11(17)9-10)26(24,25)21-7-5-20(6-8-21)15(23)12-2-4-14(22)19-18-12/h1-4,9H,5-8H2,(H,19,22).
What are the key properties of 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one?
3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one has a molecular weight of 384.36 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyridazin-6-one is sourced from PubChem (CID 9268780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).