C18H16BrN3O2 — CID 92688221
N-[(4S)-4-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-4-methylbenzamide (PubChem CID 92688221) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is N-[(4S)-4-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-4-methylbenzamide.
| Compound Name | N-[(4S)-4-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 92688221 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-[(4S)-4-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2=N[C@H](c3ccc(Br)cc3)CC(=O)N2)cc1 |
| InChI | InChI=1S/C18H16BrN3O2/c1-11-2-4-13(5-3-11)17(24)22-18-20-15(10-16(23)21-18)12-6-8-14(19)9-7-12/h2-9,15H,10H2,1H3,(H2,20,21,22,23,24)/t15-/m0/s1 |
| InChIKey | BZKHTBHHNHPBNK-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|