C20H28N2O3S — CID 92689394
1-[(2S)-5-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-2-methyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 92689394) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 1-[(2S)-5-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-2-methyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[(2S)-5-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-2-methyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 92689394 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[(2S)-5-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-2-methyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)N3CCC[C@@H]4CCCC[C@@H]43)cc2C[C@@H]1C |
| InChI | InChI=1S/C20H28N2O3S/c1-14-12-17-13-18(9-10-20(17)22(14)15(2)23)26(24,25)21-11-5-7-16-6-3-4-8-19(16)21/h9-10,13-14,16,19H,3-8,11-12H2,1-2H3/t14-,16-,19-/m0/s1 |
| InChIKey | ABIKTWPPGCYMDM-QOKNQOGYSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |