C17H12ClN3OS — CID 926921
(E)-3-(2-chlorophenyl)-N-[(3-cyanophenyl)carbamothioyl]prop-2-enamide (PubChem CID 926921) has the molecular formula C17H12ClN3OS and a molecular weight of 341.82 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(3-cyanophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(3-cyanophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 926921 |
| Molecular Formula | C17H12ClN3OS |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(3-cyanophenyl)carbamothioyl]prop-2-enamide |
| SMILES | N#Cc1cccc(NC(=S)NC(=O)/C=C/c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H12ClN3OS/c18-15-7-2-1-5-13(15)8-9-16(22)21-17(23)20-14-6-3-4-12(10-14)11-19/h1-10H,(H2,20,21,22,23)/b9-8+ |
| InChIKey | WAOPVFPPVHTVRO-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|