C17H17Cl2FN2O4S — CID 92695169
3-[(2,6-dichlorophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 92695169) has the molecular formula C17H17Cl2FN2O4S and a molecular weight of 435.30 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 92695169 |
| Molecular Formula | C17H17Cl2FN2O4S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC(=O)NO)Cc2c(Cl)cccc2Cl)ccc1F |
| InChI | InChI=1S/C17H17Cl2FN2O4S/c1-11-9-12(5-6-16(11)20)27(25,26)22(8-7-17(23)21-24)10-13-14(18)3-2-4-15(13)19/h2-6,9,24H,7-8,10H2,1H3,(H,21,23) |
| InChIKey | RTQLXACSSYPQOI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|