C25H30N4O4 — CID 92697401
(3aS,7aR)-2-[4-[benzyl-[2-(dimethylamino)ethyl]amino]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 92697401) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (3aS,7aR)-2-[4-[benzyl-[2-(dimethylamino)ethyl]amino]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[4-[benzyl-[2-(dimethylamino)ethyl]amino]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92697401 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (3aS,7aR)-2-[4-[benzyl-[2-(dimethylamino)ethyl]amino]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CN(C)CCN(Cc1ccccc1)c1ccc(N2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H30N4O4/c1-26(2)14-15-27(17-18-8-4-3-5-9-18)22-13-12-19(16-23(22)29(32)33)28-24(30)20-10-6-7-11-21(20)25(28)31/h3-5,8-9,12-13,16,20-21H,6-7,10-11,14-15,17H2,1-2H3/t20-,21+ |
| InChIKey | QQPPRBXHGATKNV-OYRHEFFESA-N |
| XLogP | 3.84 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|