C29H23N3O5 — CID 92697616
(3R)-1-[3-nitro-4-(4-phenylmethoxyanilino)phenyl]-3-phenylpyrrolidine-2,5-dione (PubChem CID 92697616) has the molecular formula C29H23N3O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is (3R)-1-[3-nitro-4-(4-phenylmethoxyanilino)phenyl]-3-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[3-nitro-4-(4-phenylmethoxyanilino)phenyl]-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92697616 |
| Molecular Formula | C29H23N3O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (3R)-1-[3-nitro-4-(4-phenylmethoxyanilino)phenyl]-3-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](c2ccccc2)C(=O)N1c1ccc(Nc2ccc(OCc3ccccc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H23N3O5/c33-28-18-25(21-9-5-2-6-10-21)29(34)31(28)23-13-16-26(27(17-23)32(35)36)30-22-11-14-24(15-12-22)37-19-20-7-3-1-4-8-20/h1-17,25,30H,18-19H2/t25-/m1/s1 |
| InChIKey | FYBKVYAXCHGNQI-RUZDIDTESA-N |
| XLogP | 5.96 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|