C20H17BrN2OS — CID 92698001
2-[(2S,6S)-2-(4-bromophenyl)-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 92698001) has the molecular formula C20H17BrN2OS and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-[(2S,6S)-2-(4-bromophenyl)-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2S,6S)-2-(4-bromophenyl)-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 92698001 |
| Molecular Formula | C20H17BrN2OS |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-[(2S,6S)-2-(4-bromophenyl)-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Oc1ccccc1[C@@H]1CC(c2cccs2)=N[C@@H](c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C20H17BrN2OS/c21-14-9-7-13(8-10-14)20-22-16(15-4-1-2-5-18(15)24)12-17(23-20)19-6-3-11-25-19/h1-11,16,20,22,24H,12H2/t16-,20-/m0/s1 |
| InChIKey | RUVSDLFTMKWXDI-JXFKEZNVSA-N |
| XLogP | 5.44 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|