C23H25N3O2 — CID 92698642
1-[(4R)-4-(3-butoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl]ethanone (PubChem CID 92698642) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(4R)-4-(3-butoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl]ethanone.
| Compound Name | 1-[(4R)-4-(3-butoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl]ethanone |
|---|---|
| PubChem CID | 92698642 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-[(4R)-4-(3-butoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl]ethanone |
| SMILES | CCCCOc1cccc([C@@H]2C(C(C)=O)=C(C)Nc3nc4ccccc4n32)c1 |
| InChI | InChI=1S/C23H25N3O2/c1-4-5-13-28-18-10-8-9-17(14-18)22-21(16(3)27)15(2)24-23-25-19-11-6-7-12-20(19)26(22)23/h6-12,14,22H,4-5,13H2,1-3H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | AXJFJLTXSCASKF-JOCHJYFZSA-N |
| XLogP | 5.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|