C26H37N3O4 — CID 92704158
(3R)-N-cyclohexyl-7-methoxy-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92704158) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-7-methoxy-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-7-methoxy-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92704158 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (3R)-N-cyclohexyl-7-methoxy-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COc1ccc2cc3n(c2c1)C[C@](C)(C(=O)NC1CCCCC1)N(CCCOC(C)C)C3=O |
| InChI | InChI=1S/C26H37N3O4/c1-18(2)33-14-8-13-29-24(30)23-15-19-11-12-21(32-4)16-22(19)28(23)17-26(29,3)25(31)27-20-9-6-5-7-10-20/h11-12,15-16,18,20H,5-10,13-14,17H2,1-4H3,(H,27,31)/t26-/m1/s1 |
| InChIKey | YOIVRYUQFRPTJB-AREMUKBSSA-N |
| XLogP | 4.13 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|