C27H39N3O5 — CID 92704184
(3R)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6,9-dimethoxy-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92704184) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is (3R)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6,9-dimethoxy-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3R)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6,9-dimethoxy-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92704184 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (3R)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6,9-dimethoxy-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COCCCN1C(=O)c2cc3c(OC)ccc(OC)c3n2C[C@]1(C)C(=O)N[C@@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C27H39N3O5/c1-17-9-7-10-20(18(17)2)28-26(32)27(3)16-29-21(25(31)30(27)13-8-14-33-4)15-19-22(34-5)11-12-23(35-6)24(19)29/h11-12,15,17-18,20H,7-10,13-14,16H2,1-6H3,(H,28,32)/t17-,18+,20-,27-/m1/s1 |
| InChIKey | CZCTUDYCNQLVLL-KSASLJLBSA-N |
| XLogP | 3.85 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|