C28H39N3O2S — CID 92704725
(3S,4S)-2-cyclopentyl-N-[3-(dipropylamino)propyl]-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 92704725) has the molecular formula C28H39N3O2S and a molecular weight of 481.71 g/mol. Its IUPAC name is (3S,4S)-2-cyclopentyl-N-[3-(dipropylamino)propyl]-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-2-cyclopentyl-N-[3-(dipropylamino)propyl]-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 92704725 |
| Molecular Formula | C28H39N3O2S |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | (3S,4S)-2-cyclopentyl-N-[3-(dipropylamino)propyl]-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)[C@H]1c2ccccc2C(=O)N(C2CCCC2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C28H39N3O2S/c1-3-17-30(18-4-2)19-10-16-29-27(32)25-22-13-7-8-14-23(22)28(33)31(21-11-5-6-12-21)26(25)24-15-9-20-34-24/h7-9,13-15,20-21,25-26H,3-6,10-12,16-19H2,1-2H3,(H,29,32)/t25-,26+/m0/s1 |
| InChIKey | FCCZGVFSSAHWDO-IZZNHLLZSA-N |
| XLogP | 5.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|