C23H19N3O4 — CID 9270620
4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 9270620) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 9270620 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)Cc2noc3ccccc23)cc1 |
| InChI | InChI=1S/C23H19N3O4/c1-29-21-9-5-3-7-18(21)25-23(28)15-10-12-16(13-11-15)24-22(27)14-19-17-6-2-4-8-20(17)30-26-19/h2-13H,14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | GXBOWPQXPHWQAJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |