C21H22BrN3O3S — CID 92708592
(2R)-N-(4-bromo-3-methylphenyl)-3-methyl-2-(quinolin-8-ylsulfonylamino)butanamide (PubChem CID 92708592) has the molecular formula C21H22BrN3O3S and a molecular weight of 476.40 g/mol. Its IUPAC name is (2R)-N-(4-bromo-3-methylphenyl)-3-methyl-2-(quinolin-8-ylsulfonylamino)butanamide.
| Compound Name | (2R)-N-(4-bromo-3-methylphenyl)-3-methyl-2-(quinolin-8-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 92708592 |
| Molecular Formula | C21H22BrN3O3S |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | (2R)-N-(4-bromo-3-methylphenyl)-3-methyl-2-(quinolin-8-ylsulfonylamino)butanamide |
| SMILES | Cc1cc(NC(=O)[C@H](NS(=O)(=O)c2cccc3cccnc23)C(C)C)ccc1Br |
| InChI | InChI=1S/C21H22BrN3O3S/c1-13(2)19(21(26)24-16-9-10-17(22)14(3)12-16)25-29(27,28)18-8-4-6-15-7-5-11-23-20(15)18/h4-13,19,25H,1-3H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | QYPVQPBLWNOPLB-LJQANCHMSA-N |
| XLogP | 4.25 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |