C19H20N2O3S — CID 92708877
(3S)-N-(3,5-dimethoxyphenyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide (PubChem CID 92708877) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (3S)-N-(3,5-dimethoxyphenyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide.
| Compound Name | (3S)-N-(3,5-dimethoxyphenyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 92708877 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3S)-N-(3,5-dimethoxyphenyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
| SMILES | COc1cc(NC(=O)C[C@@H](c2cccs2)n2cccc2)cc(OC)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-23-15-10-14(11-16(12-15)24-2)20-19(22)13-17(18-6-5-9-25-18)21-7-3-4-8-21/h3-12,17H,13H2,1-2H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | GZFFWEXNXHQEGT-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |