C21H21FN2O3 — CID 92709355
(3S)-N-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide (PubChem CID 92709355) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is (3S)-N-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide.
| Compound Name | (3S)-N-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 92709355 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (3S)-N-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide |
| SMILES | COc1ccc(NC(=O)C[C@@H](c2cccc(F)c2)n2cccc2)c(OC)c1 |
| InChI | InChI=1S/C21H21FN2O3/c1-26-17-8-9-18(20(13-17)27-2)23-21(25)14-19(24-10-3-4-11-24)15-6-5-7-16(22)12-15/h3-13,19H,14H2,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | NLEXSWCKJYCLPS-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |