C21H23ClN2O3 — CID 9270967
[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 9270967) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 9270967 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | Cc1ccccc1-c1noc(COC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)n1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-13-4-2-3-5-16(13)18-23-17(27-24-18)11-26-19(25)20-7-14-6-15(8-20)10-21(22,9-14)12-20/h2-5,14-15H,6-12H2,1H3/t14-,15+,20?,21? |
| InChIKey | VOALBQSUJHBIFF-XFKLWTPLSA-N |
| XLogP | 4.67 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|