C22H16ClN3O2 — CID 92711110
N-[(S)-(2-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzamide (PubChem CID 92711110) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is N-[(S)-(2-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzamide.
| Compound Name | N-[(S)-(2-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 92711110 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[(S)-(2-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
| SMILES | O=C(N[C@H](c1nnc(-c2ccccc2)o1)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16ClN3O2/c23-18-14-8-7-13-17(18)19(24-20(27)15-9-3-1-4-10-15)22-26-25-21(28-22)16-11-5-2-6-12-16/h1-14,19H,(H,24,27)/t19-/m0/s1 |
| InChIKey | XZUOCILPGURSEG-IBGZPJMESA-N |
| XLogP | 4.91 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |