C21H20F4N2O5 — CID 92711464
2-[(1R)-6,7-dimethoxy-2-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid (PubChem CID 92711464) has the molecular formula C21H20F4N2O5 and a molecular weight of 456.39 g/mol. Its IUPAC name is 2-[(1R)-6,7-dimethoxy-2-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid.
| Compound Name | 2-[(1R)-6,7-dimethoxy-2-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 92711464 |
| Molecular Formula | C21H20F4N2O5 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(1R)-6,7-dimethoxy-2-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid |
| SMILES | COc1cc2c(cc1OC)[C@@H](CC(=O)O)N(CC(=O)Nc1c(F)c(F)cc(F)c1F)CC2 |
| InChI | InChI=1S/C21H20F4N2O5/c1-31-15-5-10-3-4-27(14(8-18(29)30)11(10)6-16(15)32-2)9-17(28)26-21-19(24)12(22)7-13(23)20(21)25/h5-7,14H,3-4,8-9H2,1-2H3,(H,26,28)(H,29,30)/t14-/m1/s1 |
| InChIKey | SEQLINBZBYOZQX-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|