C23H34N4O3 — CID 92715204
N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[3-(4-methoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide (PubChem CID 92715204) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[3-(4-methoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide.
| Compound Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[3-(4-methoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 92715204 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[3-(4-methoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)CN1N=C(c2ccc(OC)cc2)CCC1=O |
| InChI | InChI=1S/C23H34N4O3/c1-3-19-7-4-5-15-26(19)16-6-14-24-22(28)17-27-23(29)13-12-21(25-27)18-8-10-20(30-2)11-9-18/h8-11,19H,3-7,12-17H2,1-2H3,(H,24,28)/t19-/m1/s1 |
| InChIKey | KNWMAKDGBIEFED-LJQANCHMSA-N |
| XLogP | 2.79 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|