C25H35N3O2S — CID 92721297
(11S)-N,10-dicyclohexyl-4-ethyl-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92721297) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is (11S)-N,10-dicyclohexyl-4-ethyl-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11S)-N,10-dicyclohexyl-4-ethyl-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92721297 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (11S)-N,10-dicyclohexyl-4-ethyl-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCc1cc2c(cc3n2C[C@@](C)(C(=O)NC2CCCCC2)N(C2CCCCC2)C3=O)s1 |
| InChI | InChI=1S/C25H35N3O2S/c1-3-19-14-20-22(31-19)15-21-23(29)28(18-12-8-5-9-13-18)25(2,16-27(20)21)24(30)26-17-10-6-4-7-11-17/h14-15,17-18H,3-13,16H2,1-2H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | UIHUSEJUXYLJRJ-VWLOTQADSA-N |
| XLogP | 5.26 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |