C18H17F2NO5 — CID 9272263
[2-(2,6-difluoroanilino)-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate (PubChem CID 9272263) has the molecular formula C18H17F2NO5 and a molecular weight of 365.33 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 9272263 |
| Molecular Formula | C18H17F2NO5 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccccc1OCC(=O)OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H17F2NO5/c1-2-24-14-8-3-4-9-15(14)25-11-17(23)26-10-16(22)21-18-12(19)6-5-7-13(18)20/h3-9H,2,10-11H2,1H3,(H,21,22) |
| InChIKey | VCIFDHZSKPCAJQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |