C20H22BrNO4 — CID 9272330
[2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-ethylphenoxy)acetate (PubChem CID 9272330) has the molecular formula C20H22BrNO4 and a molecular weight of 420.30 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-ethylphenoxy)acetate.
| Compound Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 9272330 |
| Molecular Formula | C20H22BrNO4 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)OCC(=O)N[C@@H](C)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H22BrNO4/c1-3-15-4-10-18(11-5-15)25-13-20(24)26-12-19(23)22-14(2)16-6-8-17(21)9-7-16/h4-11,14H,3,12-13H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | PGDGUZXGFJODHD-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |