C18H24N4O4 — CID 9272405
N'-(cyclohexanecarbonyl)-5-nitro-2-pyrrolidin-1-ylbenzohydrazide (PubChem CID 9272405) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N'-(cyclohexanecarbonyl)-5-nitro-2-pyrrolidin-1-ylbenzohydrazide.
| Compound Name | N'-(cyclohexanecarbonyl)-5-nitro-2-pyrrolidin-1-ylbenzohydrazide |
|---|---|
| PubChem CID | 9272405 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N'-(cyclohexanecarbonyl)-5-nitro-2-pyrrolidin-1-ylbenzohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCC1)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C18H24N4O4/c23-17(13-6-2-1-3-7-13)19-20-18(24)15-12-14(22(25)26)8-9-16(15)21-10-4-5-11-21/h8-9,12-13H,1-7,10-11H2,(H,19,23)(H,20,24) |
| InChIKey | UCEUYCWSILKHDA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|