C20H23N3O3 — CID 92726318
(6aS)-N-(furan-2-ylmethyl)-N,5-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 92726318) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (6aS)-N-(furan-2-ylmethyl)-N,5-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aS)-N-(furan-2-ylmethyl)-N,5-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 92726318 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (6aS)-N-(furan-2-ylmethyl)-N,5-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | CN(Cc1ccco1)C(=O)c1ccc2c(c1)N(C)C(=O)[C@@H]1CCCCN21 |
| InChI | InChI=1S/C20H23N3O3/c1-21(13-15-6-5-11-26-15)19(24)14-8-9-16-18(12-14)22(2)20(25)17-7-3-4-10-23(16)17/h5-6,8-9,11-12,17H,3-4,7,10,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | KHKVWWBOKPXNCJ-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |