C20H21N3O3S — CID 92727068
(3R)-1-(3-acetamidophenyl)-N-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 92727068) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is (3R)-1-(3-acetamidophenyl)-N-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-acetamidophenyl)-N-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92727068 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (3R)-1-(3-acetamidophenyl)-N-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1cccc(NC(=O)[C@@H]2CC(=O)N(c3cccc(NC(C)=O)c3)C2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-13(24)21-15-5-3-7-17(10-15)23-12-14(9-19(23)25)20(26)22-16-6-4-8-18(11-16)27-2/h3-8,10-11,14H,9,12H2,1-2H3,(H,21,24)(H,22,26)/t14-/m1/s1 |
| InChIKey | LZBOPCSSBPISEO-CQSZACIVSA-N |
| XLogP | 3.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |