C24H23ClN2O3 — CID 92727554
(2R)-1-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 92727554) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is (2R)-1-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-3-(4-methoxyphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-3-(4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 92727554 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2R)-1-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OC[C@H](O)Cn2c(Cc3ccccc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-29-19-10-12-20(13-11-19)30-16-18(28)15-27-23-9-5-4-8-22(23)26-24(27)14-17-6-2-3-7-21(17)25/h2-13,18,28H,14-16H2,1H3/t18-/m1/s1 |
| InChIKey | JPSJHQVDIYGGEX-GOSISDBHSA-N |
| XLogP | 4.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |