C23H29N3O5S — CID 92729225
(3R)-1-[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]-N-propylpiperidine-3-carboxamide (PubChem CID 92729225) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is (3R)-1-[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92729225 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (3R)-1-[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(OC)cc3)cc2)C1 |
| InChI | InChI=1S/C23H29N3O5S/c1-3-14-24-22(27)18-5-4-15-26(16-18)23(28)17-6-8-19(9-7-17)25-32(29,30)21-12-10-20(31-2)11-13-21/h6-13,18,25H,3-5,14-16H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | RNYYSVPUCJLKID-GOSISDBHSA-N |
| XLogP | 2.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |