C22H24FN3O4 — CID 92729847
(2R)-1-[4-[(4-fluorobenzoyl)amino]benzoyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 92729847) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is (2R)-1-[4-[(4-fluorobenzoyl)amino]benzoyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[4-[(4-fluorobenzoyl)amino]benzoyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92729847 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2R)-1-[4-[(4-fluorobenzoyl)amino]benzoyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN1C(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H24FN3O4/c1-30-14-12-24-21(28)19-3-2-13-26(19)22(29)16-6-10-18(11-7-16)25-20(27)15-4-8-17(23)9-5-15/h4-11,19H,2-3,12-14H2,1H3,(H,24,28)(H,25,27)/t19-/m1/s1 |
| InChIKey | ICCKHZCRMZHMJN-LJQANCHMSA-N |
| XLogP | 2.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|