C19H28N2O5 — CID 92731028
(2S)-1-(2,5-diethoxyphenyl)-N-(2-methoxyethyl)-2-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 92731028) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S)-1-(2,5-diethoxyphenyl)-N-(2-methoxyethyl)-2-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2,5-diethoxyphenyl)-N-(2-methoxyethyl)-2-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92731028 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2S)-1-(2,5-diethoxyphenyl)-N-(2-methoxyethyl)-2-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)CC[C@@]2(C)C(=O)NCCOC)c1 |
| InChI | InChI=1S/C19H28N2O5/c1-5-25-14-7-8-16(26-6-2)15(13-14)21-17(22)9-10-19(21,3)18(23)20-11-12-24-4/h7-8,13H,5-6,9-12H2,1-4H3,(H,20,23)/t19-/m0/s1 |
| InChIKey | QUUBNIWEXMYCGP-IBGZPJMESA-N |
| XLogP | 2.13 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|