C27H32FN3O3 — CID 92733204
(6R)-N-(3-ethoxypropyl)-6-(4-fluorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide (PubChem CID 92733204) has the molecular formula C27H32FN3O3 and a molecular weight of 465.57 g/mol. Its IUPAC name is (6R)-N-(3-ethoxypropyl)-6-(4-fluorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (6R)-N-(3-ethoxypropyl)-6-(4-fluorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92733204 |
| Molecular Formula | C27H32FN3O3 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (6R)-N-(3-ethoxypropyl)-6-(4-fluorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide |
| SMILES | CCOCCCNC(=O)N1c2ccccc2NC2=C(C(=O)CC(C)(C)C2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H32FN3O3/c1-4-34-15-7-14-29-26(33)31-22-9-6-5-8-20(22)30-21-16-27(2,3)17-23(32)24(21)25(31)18-10-12-19(28)13-11-18/h5-6,8-13,25,30H,4,7,14-17H2,1-3H3,(H,29,33)/t25-/m1/s1 |
| InChIKey | MHSGLEOBLAINQG-RUZDIDTESA-N |
| XLogP | 5.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|