About (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide
(2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 92734417) has the molecular formula C23H28N2O4
and a molecular weight of 396.49 g/mol. Its IUPAC name is (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide |
| PubChem CID | 92734417 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC[C@]2(C)C(=O)NCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-23(22(27)24-16-17-7-5-4-6-8-17)13-11-21(26)25(23)14-12-18-9-10-19(28-2)15-20(18)29-3/h4-10,15H,11-14,16H2,1-3H3,(H,24,27)/t23-/m1/s1 |
| InChIKey | YBZYLUGRHFQHES-HSZRJFAPSA-N |
| XLogP | 2.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide?
The IUPAC name of (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide (CID 92734417) is (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide.
What is the SMILES notation for (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide?
The canonical SMILES for (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide is COc1ccc(CCN2C(=O)CC[C@]2(C)C(=O)NCc2ccccc2)c(OC)c1.
What is the InChIKey of (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide?
The InChIKey is YBZYLUGRHFQHES-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H28N2O4/c1-23(22(27)24-16-17-7-5-4-6-8-17)13-11-21(26)25(23)14-12-18-9-10-19(28-2)15-20(18)29-3/h4-10,15H,11-14,16H2,1-3H3,(H,24,27)/t23-/m1/s1.
What are the key properties of (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide?
(2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide has a molecular weight of 396.49 g/mol, XLogP of 2.94, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-benzyl-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxopyrrolidine-2-carboxamide is sourced from PubChem (CID 92734417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).