C25H22ClN3O2 — CID 92734517
(2R)-N-(3-chlorophenyl)-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)butanamide (PubChem CID 92734517) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is (2R)-N-(3-chlorophenyl)-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)butanamide.
| Compound Name | (2R)-N-(3-chlorophenyl)-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)butanamide |
|---|---|
| PubChem CID | 92734517 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2R)-N-(3-chlorophenyl)-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)butanamide |
| SMILES | CC[C@H](C(=O)Nc1cccc(Cl)c1)N1C(=O)CN=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H22ClN3O2/c1-2-21(25(31)28-19-12-8-11-18(26)15-19)29-22-14-7-6-13-20(22)24(27-16-23(29)30)17-9-4-3-5-10-17/h3-15,21H,2,16H2,1H3,(H,28,31)/t21-/m1/s1 |
| InChIKey | WJCRVUOKGBZTIK-OAQYLSRUSA-N |
| XLogP | 4.94 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |