C24H27N3O2S — CID 92737297
(11S)-N-cyclopentyl-10-(3,4-dimethylphenyl)-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92737297) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is (11S)-N-cyclopentyl-10-(3,4-dimethylphenyl)-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11S)-N-cyclopentyl-10-(3,4-dimethylphenyl)-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92737297 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (11S)-N-cyclopentyl-10-(3,4-dimethylphenyl)-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3cc4sccc4n3C[C@@]2(C)C(=O)NC2CCCC2)cc1C |
| InChI | InChI=1S/C24H27N3O2S/c1-15-8-9-18(12-16(15)2)27-22(28)20-13-21-19(10-11-30-21)26(20)14-24(27,3)23(29)25-17-6-4-5-7-17/h8-13,17H,4-7,14H2,1-3H3,(H,25,29)/t24-/m0/s1 |
| InChIKey | AGSVXVBFDLAMNS-DEOSSOPVSA-N |
| XLogP | 4.80 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |