C24H34N4O2S2 — CID 92738613
(6S)-N-cyclohexyl-6-methyl-4-oxo-5-(3-propylsulfanylpropyl)-2-thiophen-2-yl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide (PubChem CID 92738613) has the molecular formula C24H34N4O2S2 and a molecular weight of 474.70 g/mol. Its IUPAC name is (6S)-N-cyclohexyl-6-methyl-4-oxo-5-(3-propylsulfanylpropyl)-2-thiophen-2-yl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | (6S)-N-cyclohexyl-6-methyl-4-oxo-5-(3-propylsulfanylpropyl)-2-thiophen-2-yl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 92738613 |
| Molecular Formula | C24H34N4O2S2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (6S)-N-cyclohexyl-6-methyl-4-oxo-5-(3-propylsulfanylpropyl)-2-thiophen-2-yl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
| SMILES | CCCSCCCN1C(=O)c2cc(-c3cccs3)nn2C[C@@]1(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H34N4O2S2/c1-3-13-31-14-8-12-27-22(29)20-16-19(21-11-7-15-32-21)26-28(20)17-24(27,2)23(30)25-18-9-5-4-6-10-18/h7,11,15-16,18H,3-6,8-10,12-14,17H2,1-2H3,(H,25,30)/t24-/m0/s1 |
| InChIKey | MHMREAFFNBKPOA-DEOSSOPVSA-N |
| XLogP | 4.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|