C27H32N4O3 — CID 92739425
(6R)-5-[(4-ethylphenyl)methyl]-N-(3-methoxypropyl)-6-methyl-4-oxo-2-phenyl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide (PubChem CID 92739425) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is (6R)-5-[(4-ethylphenyl)methyl]-N-(3-methoxypropyl)-6-methyl-4-oxo-2-phenyl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | (6R)-5-[(4-ethylphenyl)methyl]-N-(3-methoxypropyl)-6-methyl-4-oxo-2-phenyl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 92739425 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (6R)-5-[(4-ethylphenyl)methyl]-N-(3-methoxypropyl)-6-methyl-4-oxo-2-phenyl-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
| SMILES | CCc1ccc(CN2C(=O)c3cc(-c4ccccc4)nn3C[C@]2(C)C(=O)NCCCOC)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-4-20-11-13-21(14-12-20)18-30-25(32)24-17-23(22-9-6-5-7-10-22)29-31(24)19-27(30,2)26(33)28-15-8-16-34-3/h5-7,9-14,17H,4,8,15-16,18-19H2,1-3H3,(H,28,33)/t27-/m1/s1 |
| InChIKey | FUHXJWFFTHPPFP-HHHXNRCGSA-N |
| XLogP | 3.68 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|