C9H8Cl2N4 — CID 927395
N-[(2,6-dichlorophenyl)methyl]-1H-1,2,4-triazol-5-amine (PubChem CID 927395) has the molecular formula C9H8Cl2N4 and a molecular weight of 243.10 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 927395 |
| Molecular Formula | C9H8Cl2N4 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Clc1cccc(Cl)c1CNc1ncn[nH]1 |
| InChI | InChI=1S/C9H8Cl2N4/c10-7-2-1-3-8(11)6(7)4-12-9-13-5-14-15-9/h1-3,5H,4H2,(H2,12,13,14,15) |
| InChIKey | CFUGURZOKBKZEX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |