C24H33N3O3 — CID 92739929
(3S)-N-cycloheptyl-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92739929) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (3S)-N-cycloheptyl-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3S)-N-cycloheptyl-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92739929 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (3S)-N-cycloheptyl-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COCCCN1C(=O)c2cc3ccccc3n2C[C@@]1(C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(23(29)25-19-11-5-3-4-6-12-19)17-26-20-13-8-7-10-18(20)16-21(26)22(28)27(24)14-9-15-30-2/h7-8,10,13,16,19H,3-6,9,11-12,14-15,17H2,1-2H3,(H,25,29)/t24-/m0/s1 |
| InChIKey | MMMKOAQEPYQBQK-DEOSSOPVSA-N |
| XLogP | 3.73 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|