C28H34N4O2 — CID 92740728
(3R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide (PubChem CID 92740728) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (3R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | (3R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 92740728 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (3R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide |
| SMILES | Cc1ccccc1CN1C(=O)c2nc3ccccc3n2C[C@]1(C)C(=O)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C28H34N4O2/c1-18-11-9-14-22(20(18)3)30-27(34)28(4)17-31-24-15-8-7-13-23(24)29-25(31)26(33)32(28)16-21-12-6-5-10-19(21)2/h5-8,10,12-13,15,18,20,22H,9,11,14,16-17H2,1-4H3,(H,30,34)/t18-,20+,22+,28+/m0/s1 |
| InChIKey | GGABXKKCNUXEHU-BSEDZZRKSA-N |
| XLogP | 4.70 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |