C26H36N4O5 — CID 92741674
(3R)-10-acetamido-N-cyclopentyl-2-(3-ethoxypropyl)-8-methoxy-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92741674) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is (3R)-10-acetamido-N-cyclopentyl-2-(3-ethoxypropyl)-8-methoxy-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3R)-10-acetamido-N-cyclopentyl-2-(3-ethoxypropyl)-8-methoxy-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92741674 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (3R)-10-acetamido-N-cyclopentyl-2-(3-ethoxypropyl)-8-methoxy-3-methyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | CCOCCCN1C(=O)c2c(NC(C)=O)c3cc(OC)ccc3n2C[C@]1(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C26H36N4O5/c1-5-35-14-8-13-30-24(32)23-22(27-17(2)31)20-15-19(34-4)11-12-21(20)29(23)16-26(30,3)25(33)28-18-9-6-7-10-18/h11-12,15,18H,5-10,13-14,16H2,1-4H3,(H,27,31)(H,28,33)/t26-/m1/s1 |
| InChIKey | BYZVTTCXLINKAZ-AREMUKBSSA-N |
| XLogP | 3.31 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|